C16H25Cl2N3 — CID 103776344
N-[1-(2,3-dichlorophenyl)ethyl]-3-(4-methylpiperazin-1-yl)propan-1-amine (PubChem CID 103776344) has the molecular formula C16H25Cl2N3 and a molecular weight of 330.30 g/mol. Its IUPAC name is N-[1-(2,3-dichlorophenyl)ethyl]-3-(4-methylpiperazin-1-yl)propan-1-amine.
| Compound Name | N-[1-(2,3-dichlorophenyl)ethyl]-3-(4-methylpiperazin-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 103776344 |
| Molecular Formula | C16H25Cl2N3 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-[1-(2,3-dichlorophenyl)ethyl]-3-(4-methylpiperazin-1-yl)propan-1-amine |
| SMILES | CC(NCCCN1CCN(C)CC1)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H25Cl2N3/c1-13(14-5-3-6-15(17)16(14)18)19-7-4-8-21-11-9-20(2)10-12-21/h3,5-6,13,19H,4,7-12H2,1-2H3 |
| InChIKey | MQCBBLZDCLRELD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|