C13H18ClNO2 — CID 60694137
methyl 4-[1-(2-chlorophenyl)ethylamino]butanoate (PubChem CID 60694137) has the molecular formula C13H18ClNO2 and a molecular weight of 255.75 g/mol. Its IUPAC name is methyl 4-[1-(2-chlorophenyl)ethylamino]butanoate.
| Compound Name | methyl 4-[1-(2-chlorophenyl)ethylamino]butanoate |
|---|---|
| PubChem CID | 60694137 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | methyl 4-[1-(2-chlorophenyl)ethylamino]butanoate |
| SMILES | COC(=O)CCCNC(C)c1ccccc1Cl |
| InChI | InChI=1S/C13H18ClNO2/c1-10(11-6-3-4-7-12(11)14)15-9-5-8-13(16)17-2/h3-4,6-7,10,15H,5,8-9H2,1-2H3 |
| InChIKey | SQWUXMWIBYMGDW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|