C15H25ClN2O2 — CID 159889089
methyl N-[2-[1-(2-chlorophenyl)ethylamino]ethyl]carbamate;propane (PubChem CID 159889089) has the molecular formula C15H25ClN2O2 and a molecular weight of 300.83 g/mol. Its IUPAC name is methyl N-[2-[1-(2-chlorophenyl)ethylamino]ethyl]carbamate;propane.
| Compound Name | methyl N-[2-[1-(2-chlorophenyl)ethylamino]ethyl]carbamate;propane |
|---|---|
| PubChem CID | 159889089 |
| Molecular Formula | C15H25ClN2O2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | methyl N-[2-[1-(2-chlorophenyl)ethylamino]ethyl]carbamate;propane |
| SMILES | CCC.COC(=O)NCCNC(C)c1ccccc1Cl |
| InChI | InChI=1S/C12H17ClN2O2.C3H8/c1-9(10-5-3-4-6-11(10)13)14-7-8-15-12(16)17-2;1-3-2/h3-6,9,14H,7-8H2,1-2H3,(H,15,16);3H2,1-2H3 |
| InChIKey | NUMZBZFFRUFAJS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|