C11H19NO3 — CID 60815401
2,2-dimethoxy-N-[1-(5-methylfuran-2-yl)ethyl]ethanamine (PubChem CID 60815401) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2,2-dimethoxy-N-[1-(5-methylfuran-2-yl)ethyl]ethanamine.
| Compound Name | 2,2-dimethoxy-N-[1-(5-methylfuran-2-yl)ethyl]ethanamine |
|---|---|
| PubChem CID | 60815401 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 2,2-dimethoxy-N-[1-(5-methylfuran-2-yl)ethyl]ethanamine |
| SMILES | COC(CNC(C)c1ccc(C)o1)OC |
| InChI | InChI=1S/C11H19NO3/c1-8-5-6-10(15-8)9(2)12-7-11(13-3)14-4/h5-6,9,11-12H,7H2,1-4H3 |
| InChIKey | HCHREQXCFNQGSK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|