C10H18N2O3S — CID 102676052
N-methyl-2-[1-(5-methylfuran-2-yl)ethylamino]ethanesulfonamide (PubChem CID 102676052) has the molecular formula C10H18N2O3S and a molecular weight of 246.33 g/mol. Its IUPAC name is N-methyl-2-[1-(5-methylfuran-2-yl)ethylamino]ethanesulfonamide.
| Compound Name | N-methyl-2-[1-(5-methylfuran-2-yl)ethylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 102676052 |
| Molecular Formula | C10H18N2O3S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N-methyl-2-[1-(5-methylfuran-2-yl)ethylamino]ethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNC(C)c1ccc(C)o1 |
| InChI | InChI=1S/C10H18N2O3S/c1-8-4-5-10(15-8)9(2)12-6-7-16(13,14)11-3/h4-5,9,11-12H,6-7H2,1-3H3 |
| InChIKey | QTQIIWIRMWTXMS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |