C12H20BrNOS2 — CID 97322543
(1R)-1-(5-bromothiophen-2-yl)-N-[2-[(R)-tert-butylsulfinyl]ethyl]ethanamine (PubChem CID 97322543) has the molecular formula C12H20BrNOS2 and a molecular weight of 338.34 g/mol. Its IUPAC name is (1R)-1-(5-bromothiophen-2-yl)-N-[2-[(R)-tert-butylsulfinyl]ethyl]ethanamine.
| Compound Name | (1R)-1-(5-bromothiophen-2-yl)-N-[2-[(R)-tert-butylsulfinyl]ethyl]ethanamine |
|---|---|
| PubChem CID | 97322543 |
| Molecular Formula | C12H20BrNOS2 |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | (1R)-1-(5-bromothiophen-2-yl)-N-[2-[(R)-tert-butylsulfinyl]ethyl]ethanamine |
| SMILES | C[C@@H](NCC[S@@](=O)C(C)(C)C)c1ccc(Br)s1 |
| InChI | InChI=1S/C12H20BrNOS2/c1-9(10-5-6-11(13)16-10)14-7-8-17(15)12(2,3)4/h5-6,9,14H,7-8H2,1-4H3/t9-,17-/m1/s1 |
| InChIKey | LHAWZDWMQFUVFL-VVVCHXIZSA-N |
| XLogP | 3.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |