C14H22BrNS — CID 106008220
N-[1-(5-bromothiophen-2-yl)ethyl]-3-cyclopentylpropan-1-amine (PubChem CID 106008220) has the molecular formula C14H22BrNS and a molecular weight of 316.31 g/mol. Its IUPAC name is N-[1-(5-bromothiophen-2-yl)ethyl]-3-cyclopentylpropan-1-amine.
| Compound Name | N-[1-(5-bromothiophen-2-yl)ethyl]-3-cyclopentylpropan-1-amine |
|---|---|
| PubChem CID | 106008220 |
| Molecular Formula | C14H22BrNS |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | N-[1-(5-bromothiophen-2-yl)ethyl]-3-cyclopentylpropan-1-amine |
| SMILES | CC(NCCCC1CCCC1)c1ccc(Br)s1 |
| InChI | InChI=1S/C14H22BrNS/c1-11(13-8-9-14(15)17-13)16-10-4-7-12-5-2-3-6-12/h8-9,11-12,16H,2-7,10H2,1H3 |
| InChIKey | ISTDEGAXSMXXMF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|