C13H20F3NS — CID 113327120
N-[1-(5-ethylthiophen-2-yl)ethyl]-5,5,5-trifluoropentan-1-amine (PubChem CID 113327120) has the molecular formula C13H20F3NS and a molecular weight of 279.37 g/mol. Its IUPAC name is N-[1-(5-ethylthiophen-2-yl)ethyl]-5,5,5-trifluoropentan-1-amine.
| Compound Name | N-[1-(5-ethylthiophen-2-yl)ethyl]-5,5,5-trifluoropentan-1-amine |
|---|---|
| PubChem CID | 113327120 |
| Molecular Formula | C13H20F3NS |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | N-[1-(5-ethylthiophen-2-yl)ethyl]-5,5,5-trifluoropentan-1-amine |
| SMILES | CCc1ccc(C(C)NCCCCC(F)(F)F)s1 |
| InChI | InChI=1S/C13H20F3NS/c1-3-11-6-7-12(18-11)10(2)17-9-5-4-8-13(14,15)16/h6-7,10,17H,3-5,8-9H2,1-2H3 |
| InChIKey | KKKDQDGCOVXQOP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|