C13H16BrF4N — CID 103904216
N-[1-(2-bromo-4-fluorophenyl)ethyl]-5,5,5-trifluoropentan-1-amine (PubChem CID 103904216) has the molecular formula C13H16BrF4N and a molecular weight of 342.17 g/mol. Its IUPAC name is N-[1-(2-bromo-4-fluorophenyl)ethyl]-5,5,5-trifluoropentan-1-amine.
| Compound Name | N-[1-(2-bromo-4-fluorophenyl)ethyl]-5,5,5-trifluoropentan-1-amine |
|---|---|
| PubChem CID | 103904216 |
| Molecular Formula | C13H16BrF4N |
| Molecular Weight | 342.17 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | N-[1-(2-bromo-4-fluorophenyl)ethyl]-5,5,5-trifluoropentan-1-amine |
| SMILES | CC(NCCCCC(F)(F)F)c1ccc(F)cc1Br |
| InChI | InChI=1S/C13H16BrF4N/c1-9(11-5-4-10(15)8-12(11)14)19-7-3-2-6-13(16,17)18/h4-5,8-9,19H,2-3,6-7H2,1H3 |
| InChIKey | XRKMKDVUVPBJCO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.17 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|