C13H20BrFN2 — CID 103775462
N-[1-(2-bromo-4-fluorophenyl)ethyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 103775462) has the molecular formula C13H20BrFN2 and a molecular weight of 303.22 g/mol. Its IUPAC name is N-[1-(2-bromo-4-fluorophenyl)ethyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[1-(2-bromo-4-fluorophenyl)ethyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 103775462 |
| Molecular Formula | C13H20BrFN2 |
| Molecular Weight | 303.22 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | N-[1-(2-bromo-4-fluorophenyl)ethyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CC(NCCCN(C)C)c1ccc(F)cc1Br |
| InChI | InChI=1S/C13H20BrFN2/c1-10(16-7-4-8-17(2)3)12-6-5-11(15)9-13(12)14/h5-6,9-10,16H,4,7-8H2,1-3H3 |
| InChIKey | ISVRYMBOBQUSMT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.22 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|