C15H15BrFN — CID 103775782
N-benzyl-1-(2-bromo-4-fluorophenyl)ethanamine (PubChem CID 103775782) has the molecular formula C15H15BrFN and a molecular weight of 308.19 g/mol. Its IUPAC name is N-benzyl-1-(2-bromo-4-fluorophenyl)ethanamine.
| Compound Name | N-benzyl-1-(2-bromo-4-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 103775782 |
| Molecular Formula | C15H15BrFN |
| Molecular Weight | 308.19 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | N-benzyl-1-(2-bromo-4-fluorophenyl)ethanamine |
| SMILES | CC(NCc1ccccc1)c1ccc(F)cc1Br |
| InChI | InChI=1S/C15H15BrFN/c1-11(14-8-7-13(17)9-15(14)16)18-10-12-5-3-2-4-6-12/h2-9,11,18H,10H2,1H3 |
| InChIKey | QAVUPJQPDZJVJA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.19 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |