C11H12Br2FN — CID 115717189
2-bromo-N-[1-(2-bromo-4-fluorophenyl)ethyl]prop-2-en-1-amine (PubChem CID 115717189) has the molecular formula C11H12Br2FN and a molecular weight of 337.03 g/mol. Its IUPAC name is 2-bromo-N-[1-(2-bromo-4-fluorophenyl)ethyl]prop-2-en-1-amine.
| Compound Name | 2-bromo-N-[1-(2-bromo-4-fluorophenyl)ethyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 115717189 |
| Molecular Formula | C11H12Br2FN |
| Molecular Weight | 337.03 g/mol |
| Exact Mass | 334.93 |
| IUPAC Name | 2-bromo-N-[1-(2-bromo-4-fluorophenyl)ethyl]prop-2-en-1-amine |
| SMILES | C=C(Br)CNC(C)c1ccc(F)cc1Br |
| InChI | InChI=1S/C11H12Br2FN/c1-7(12)6-15-8(2)10-4-3-9(14)5-11(10)13/h3-5,8,15H,1,6H2,2H3 |
| InChIKey | KUCXNHQZNNZTTI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.03 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |