C12H14BrF2N — CID 115717252
N-(2-bromoprop-2-enyl)-1-(2,4-difluorophenyl)propan-1-amine (PubChem CID 115717252) has the molecular formula C12H14BrF2N and a molecular weight of 290.15 g/mol. Its IUPAC name is N-(2-bromoprop-2-enyl)-1-(2,4-difluorophenyl)propan-1-amine.
| Compound Name | N-(2-bromoprop-2-enyl)-1-(2,4-difluorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 115717252 |
| Molecular Formula | C12H14BrF2N |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | N-(2-bromoprop-2-enyl)-1-(2,4-difluorophenyl)propan-1-amine |
| SMILES | C=C(Br)CNC(CC)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H14BrF2N/c1-3-12(16-7-8(2)13)10-5-4-9(14)6-11(10)15/h4-6,12,16H,2-3,7H2,1H3 |
| InChIKey | IHEPAKDKDTVRKI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |