C11H15BrFNO — CID 103778517
(2R)-2-[1-(2-bromo-4-fluorophenyl)ethylamino]propan-1-ol (PubChem CID 103778517) has the molecular formula C11H15BrFNO and a molecular weight of 276.15 g/mol. Its IUPAC name is (2R)-2-[1-(2-bromo-4-fluorophenyl)ethylamino]propan-1-ol.
| Compound Name | (2R)-2-[1-(2-bromo-4-fluorophenyl)ethylamino]propan-1-ol |
|---|---|
| PubChem CID | 103778517 |
| Molecular Formula | C11H15BrFNO |
| Molecular Weight | 276.15 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | (2R)-2-[1-(2-bromo-4-fluorophenyl)ethylamino]propan-1-ol |
| SMILES | CC(N[C@H](C)CO)c1ccc(F)cc1Br |
| InChI | InChI=1S/C11H15BrFNO/c1-7(6-15)14-8(2)10-4-3-9(13)5-11(10)12/h3-5,7-8,14-15H,6H2,1-2H3/t7-,8?/m1/s1 |
| InChIKey | DCQINUBRSZFWAM-GVHYBUMESA-N |
| XLogP | 2.62 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.15 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |