C12H17BrFNOS — CID 103783157
1-(2-bromo-4-fluorophenyl)-N-(2-ethylsulfinylethyl)ethanamine (PubChem CID 103783157) has the molecular formula C12H17BrFNOS and a molecular weight of 322.24 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)-N-(2-ethylsulfinylethyl)ethanamine.
| Compound Name | 1-(2-bromo-4-fluorophenyl)-N-(2-ethylsulfinylethyl)ethanamine |
|---|---|
| PubChem CID | 103783157 |
| Molecular Formula | C12H17BrFNOS |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)-N-(2-ethylsulfinylethyl)ethanamine |
| SMILES | CCS(=O)CCNC(C)c1ccc(F)cc1Br |
| InChI | InChI=1S/C12H17BrFNOS/c1-3-17(16)7-6-15-9(2)11-5-4-10(14)8-12(11)13/h4-5,8-9,15H,3,6-7H2,1-2H3 |
| InChIKey | UDPDDHRLBUBQJZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |