C14H19BrFNO2 — CID 103917117
tert-butyl 2-[1-(2-bromo-4-fluorophenyl)ethylamino]acetate (PubChem CID 103917117) has the molecular formula C14H19BrFNO2 and a molecular weight of 332.21 g/mol. Its IUPAC name is tert-butyl 2-[1-(2-bromo-4-fluorophenyl)ethylamino]acetate.
| Compound Name | tert-butyl 2-[1-(2-bromo-4-fluorophenyl)ethylamino]acetate |
|---|---|
| PubChem CID | 103917117 |
| Molecular Formula | C14H19BrFNO2 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | tert-butyl 2-[1-(2-bromo-4-fluorophenyl)ethylamino]acetate |
| SMILES | CC(NCC(=O)OC(C)(C)C)c1ccc(F)cc1Br |
| InChI | InChI=1S/C14H19BrFNO2/c1-9(11-6-5-10(16)7-12(11)15)17-8-13(18)19-14(2,3)4/h5-7,9,17H,8H2,1-4H3 |
| InChIKey | UTNHPLSALNYZQY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |