C13H19BrFNO2S — CID 103787855
N-[1-(2-bromo-4-fluorophenyl)ethyl]-2-methyl-2-methylsulfonylpropan-1-amine (PubChem CID 103787855) has the molecular formula C13H19BrFNO2S and a molecular weight of 352.27 g/mol. Its IUPAC name is N-[1-(2-bromo-4-fluorophenyl)ethyl]-2-methyl-2-methylsulfonylpropan-1-amine.
| Compound Name | N-[1-(2-bromo-4-fluorophenyl)ethyl]-2-methyl-2-methylsulfonylpropan-1-amine |
|---|---|
| PubChem CID | 103787855 |
| Molecular Formula | C13H19BrFNO2S |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | N-[1-(2-bromo-4-fluorophenyl)ethyl]-2-methyl-2-methylsulfonylpropan-1-amine |
| SMILES | CC(NCC(C)(C)S(C)(=O)=O)c1ccc(F)cc1Br |
| InChI | InChI=1S/C13H19BrFNO2S/c1-9(11-6-5-10(15)7-12(11)14)16-8-13(2,3)19(4,17)18/h5-7,9,16H,8H2,1-4H3 |
| InChIKey | XFCCKAZXFIIMDY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |