C14H20BrFN2O — CID 103776829
2-[1-(2-bromo-4-fluorophenyl)ethylamino]-N-tert-butylacetamide (PubChem CID 103776829) has the molecular formula C14H20BrFN2O and a molecular weight of 331.23 g/mol. Its IUPAC name is 2-[1-(2-bromo-4-fluorophenyl)ethylamino]-N-tert-butylacetamide.
| Compound Name | 2-[1-(2-bromo-4-fluorophenyl)ethylamino]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 103776829 |
| Molecular Formula | C14H20BrFN2O |
| Molecular Weight | 331.23 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2-[1-(2-bromo-4-fluorophenyl)ethylamino]-N-tert-butylacetamide |
| SMILES | CC(NCC(=O)NC(C)(C)C)c1ccc(F)cc1Br |
| InChI | InChI=1S/C14H20BrFN2O/c1-9(11-6-5-10(16)7-12(11)15)17-8-13(19)18-14(2,3)4/h5-7,9,17H,8H2,1-4H3,(H,18,19) |
| InChIKey | YSUYWFDMPJVKSL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.23 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |