C14H22N2O3 — CID 115356029
N-tert-butyl-2-[1-(2,5-dihydroxyphenyl)ethylamino]acetamide (PubChem CID 115356029) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is N-tert-butyl-2-[1-(2,5-dihydroxyphenyl)ethylamino]acetamide.
| Compound Name | N-tert-butyl-2-[1-(2,5-dihydroxyphenyl)ethylamino]acetamide |
|---|---|
| PubChem CID | 115356029 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | N-tert-butyl-2-[1-(2,5-dihydroxyphenyl)ethylamino]acetamide |
| SMILES | CC(NCC(=O)NC(C)(C)C)c1cc(O)ccc1O |
| InChI | InChI=1S/C14H22N2O3/c1-9(11-7-10(17)5-6-12(11)18)15-8-13(19)16-14(2,3)4/h5-7,9,15,17-18H,8H2,1-4H3,(H,16,19) |
| InChIKey | NXLIGSHHDVNRKZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|