C13H18BrFN2O — CID 81422388
2-[(2-bromo-4-fluorophenyl)methylamino]-N-tert-butylacetamide (PubChem CID 81422388) has the molecular formula C13H18BrFN2O and a molecular weight of 317.20 g/mol. Its IUPAC name is 2-[(2-bromo-4-fluorophenyl)methylamino]-N-tert-butylacetamide.
| Compound Name | 2-[(2-bromo-4-fluorophenyl)methylamino]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 81422388 |
| Molecular Formula | C13H18BrFN2O |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 2-[(2-bromo-4-fluorophenyl)methylamino]-N-tert-butylacetamide |
| SMILES | CC(C)(C)NC(=O)CNCc1ccc(F)cc1Br |
| InChI | InChI=1S/C13H18BrFN2O/c1-13(2,3)17-12(18)8-16-7-9-4-5-10(15)6-11(9)14/h4-6,16H,7-8H2,1-3H3,(H,17,18) |
| InChIKey | WQFLKBMCSFTWDB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |