C14H19BrFNO2 — CID 122073113
2-[[(2-bromo-4-fluorophenyl)methylamino]methyl]-4-methylpentanoic acid (PubChem CID 122073113) has the molecular formula C14H19BrFNO2 and a molecular weight of 332.21 g/mol. Its IUPAC name is 2-[[(2-bromo-4-fluorophenyl)methylamino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[(2-bromo-4-fluorophenyl)methylamino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122073113 |
| Molecular Formula | C14H19BrFNO2 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 2-[[(2-bromo-4-fluorophenyl)methylamino]methyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(CNCc1ccc(F)cc1Br)C(=O)O |
| InChI | InChI=1S/C14H19BrFNO2/c1-9(2)5-11(14(18)19)8-17-7-10-3-4-12(16)6-13(10)15/h3-4,6,9,11,17H,5,7-8H2,1-2H3,(H,18,19) |
| InChIKey | DFZBMTPOJGNYDE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |