C13H20BrNO3S — CID 122127736
2-[[(4-bromo-5-methoxythiophen-2-yl)methylamino]methyl]-4-methylpentanoic acid (PubChem CID 122127736) has the molecular formula C13H20BrNO3S and a molecular weight of 350.28 g/mol. Its IUPAC name is 2-[[(4-bromo-5-methoxythiophen-2-yl)methylamino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[(4-bromo-5-methoxythiophen-2-yl)methylamino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 122127736 |
| Molecular Formula | C13H20BrNO3S |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 2-[[(4-bromo-5-methoxythiophen-2-yl)methylamino]methyl]-4-methylpentanoic acid |
| SMILES | COc1sc(CNCC(CC(C)C)C(=O)O)cc1Br |
| InChI | InChI=1S/C13H20BrNO3S/c1-8(2)4-9(12(16)17)6-15-7-10-5-11(14)13(18-3)19-10/h5,8-9,15H,4,6-7H2,1-3H3,(H,16,17) |
| InChIKey | LZYAKLFDVNJVFR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |