C18H23NO2S — CID 122073039
4-methyl-2-[[(5-phenylthiophen-2-yl)methylamino]methyl]pentanoic acid (PubChem CID 122073039) has the molecular formula C18H23NO2S and a molecular weight of 317.45 g/mol. Its IUPAC name is 4-methyl-2-[[(5-phenylthiophen-2-yl)methylamino]methyl]pentanoic acid.
| Compound Name | 4-methyl-2-[[(5-phenylthiophen-2-yl)methylamino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 122073039 |
| Molecular Formula | C18H23NO2S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 4-methyl-2-[[(5-phenylthiophen-2-yl)methylamino]methyl]pentanoic acid |
| SMILES | CC(C)CC(CNCc1ccc(-c2ccccc2)s1)C(=O)O |
| InChI | InChI=1S/C18H23NO2S/c1-13(2)10-15(18(20)21)11-19-12-16-8-9-17(22-16)14-6-4-3-5-7-14/h3-9,13,15,19H,10-12H2,1-2H3,(H,20,21) |
| InChIKey | HHQYWKRZJLXOSQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |