C17H20BrNO2S — CID 120510018
2-[[5-(3-bromophenyl)thiophen-2-yl]methylamino]-4-methylpentanoic acid (PubChem CID 120510018) has the molecular formula C17H20BrNO2S and a molecular weight of 382.32 g/mol. Its IUPAC name is 2-[[5-(3-bromophenyl)thiophen-2-yl]methylamino]-4-methylpentanoic acid.
| Compound Name | 2-[[5-(3-bromophenyl)thiophen-2-yl]methylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 120510018 |
| Molecular Formula | C17H20BrNO2S |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 2-[[5-(3-bromophenyl)thiophen-2-yl]methylamino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NCc1ccc(-c2cccc(Br)c2)s1)C(=O)O |
| InChI | InChI=1S/C17H20BrNO2S/c1-11(2)8-15(17(20)21)19-10-14-6-7-16(22-14)12-4-3-5-13(18)9-12/h3-7,9,11,15,19H,8,10H2,1-2H3,(H,20,21) |
| InChIKey | YGRWUMKFAABKKP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |