C14H21NO4S — CID 82894730
2-[[5-(2-methoxy-2-oxoethyl)thiophen-2-yl]methylamino]-4-methylpentanoic acid (PubChem CID 82894730) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is 2-[[5-(2-methoxy-2-oxoethyl)thiophen-2-yl]methylamino]-4-methylpentanoic acid.
| Compound Name | 2-[[5-(2-methoxy-2-oxoethyl)thiophen-2-yl]methylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 82894730 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-[[5-(2-methoxy-2-oxoethyl)thiophen-2-yl]methylamino]-4-methylpentanoic acid |
| SMILES | COC(=O)Cc1ccc(CNC(CC(C)C)C(=O)O)s1 |
| InChI | InChI=1S/C14H21NO4S/c1-9(2)6-12(14(17)18)15-8-11-5-4-10(20-11)7-13(16)19-3/h4-5,9,12,15H,6-8H2,1-3H3,(H,17,18) |
| InChIKey | BLYXWDQDTHGNHI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |