C13H21NO3S — CID 115907658
methyl 2-[5-[(1-hydroxypentan-3-ylamino)methyl]thiophen-2-yl]acetate (PubChem CID 115907658) has the molecular formula C13H21NO3S and a molecular weight of 271.38 g/mol. Its IUPAC name is methyl 2-[5-[(1-hydroxypentan-3-ylamino)methyl]thiophen-2-yl]acetate.
| Compound Name | methyl 2-[5-[(1-hydroxypentan-3-ylamino)methyl]thiophen-2-yl]acetate |
|---|---|
| PubChem CID | 115907658 |
| Molecular Formula | C13H21NO3S |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | methyl 2-[5-[(1-hydroxypentan-3-ylamino)methyl]thiophen-2-yl]acetate |
| SMILES | CCC(CCO)NCc1ccc(CC(=O)OC)s1 |
| InChI | InChI=1S/C13H21NO3S/c1-3-10(6-7-15)14-9-12-5-4-11(18-12)8-13(16)17-2/h4-5,10,14-15H,3,6-9H2,1-2H3 |
| InChIKey | LIPRDSOAVCZQGR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |