C9H14BrNO2S — CID 103884123
(2S)-1-[(4-bromo-5-methoxythiophen-2-yl)methylamino]propan-2-ol (PubChem CID 103884123) has the molecular formula C9H14BrNO2S and a molecular weight of 280.19 g/mol. Its IUPAC name is (2S)-1-[(4-bromo-5-methoxythiophen-2-yl)methylamino]propan-2-ol.
| Compound Name | (2S)-1-[(4-bromo-5-methoxythiophen-2-yl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 103884123 |
| Molecular Formula | C9H14BrNO2S |
| Molecular Weight | 280.19 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | (2S)-1-[(4-bromo-5-methoxythiophen-2-yl)methylamino]propan-2-ol |
| SMILES | COc1sc(CNC[C@H](C)O)cc1Br |
| InChI | InChI=1S/C9H14BrNO2S/c1-6(12)4-11-5-7-3-8(10)9(13-2)14-7/h3,6,11-12H,4-5H2,1-2H3/t6-/m0/s1 |
| InChIKey | FAIMJNQKACCXNC-LURJTMIESA-N |
| XLogP | 1.99 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.19 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |