C8H11Br2NOS — CID 136585204
(2R)-1-[(3,5-dibromothiophen-2-yl)methylamino]propan-2-ol (PubChem CID 136585204) has the molecular formula C8H11Br2NOS and a molecular weight of 329.06 g/mol. Its IUPAC name is (2R)-1-[(3,5-dibromothiophen-2-yl)methylamino]propan-2-ol.
| Compound Name | (2R)-1-[(3,5-dibromothiophen-2-yl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 136585204 |
| Molecular Formula | C8H11Br2NOS |
| Molecular Weight | 329.06 g/mol |
| Exact Mass | 326.89 |
| IUPAC Name | (2R)-1-[(3,5-dibromothiophen-2-yl)methylamino]propan-2-ol |
| SMILES | C[C@@H](O)CNCc1sc(Br)cc1Br |
| InChI | InChI=1S/C8H11Br2NOS/c1-5(12)3-11-4-7-6(9)2-8(10)13-7/h2,5,11-12H,3-4H2,1H3/t5-/m1/s1 |
| InChIKey | WHFCNYGRUCSLOL-RXMQYKEDSA-N |
| XLogP | 2.74 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.06 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |