About 1-[(2-methyl-1,3-thiazol-5-yl)methylamino]propan-2-ol
1-[(2-methyl-1,3-thiazol-5-yl)methylamino]propan-2-ol (PubChem CID 60941890) has the molecular formula C8H14N2OS
and a molecular weight of 186.28 g/mol. Its IUPAC name is 1-[(2-methyl-1,3-thiazol-5-yl)methylamino]propan-2-ol.
Analyze 1-[(2-methyl-1,3-thiazol-5-yl)methylamino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-methyl-1,3-thiazol-5-yl)methylamino]propan-2-ol?
The IUPAC name of 1-[(2-methyl-1,3-thiazol-5-yl)methylamino]propan-2-ol (CID 60941890) is 1-[(2-methyl-1,3-thiazol-5-yl)methylamino]propan-2-ol.
What is the SMILES notation for 1-[(2-methyl-1,3-thiazol-5-yl)methylamino]propan-2-ol?
The canonical SMILES for 1-[(2-methyl-1,3-thiazol-5-yl)methylamino]propan-2-ol is Cc1ncc(CNCC(C)O)s1.
What is the InChIKey of 1-[(2-methyl-1,3-thiazol-5-yl)methylamino]propan-2-ol?
The InChIKey is UUTSGNADEQHYQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2OS/c1-6(11)3-9-4-8-5-10-7(2)12-8/h5-6,9,11H,3-4H2,1-2H3.
What are the key properties of 1-[(2-methyl-1,3-thiazol-5-yl)methylamino]propan-2-ol?
1-[(2-methyl-1,3-thiazol-5-yl)methylamino]propan-2-ol has a molecular weight of 186.28 g/mol, XLogP of 0.92, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-methyl-1,3-thiazol-5-yl)methylamino]propan-2-ol is sourced from PubChem (CID 60941890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).