C7H9N3S — CID 61280637
2-[(2-methyl-1,3-thiazol-5-yl)methylamino]acetonitrile (PubChem CID 61280637) has the molecular formula C7H9N3S and a molecular weight of 167.24 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-thiazol-5-yl)methylamino]acetonitrile.
| Compound Name | 2-[(2-methyl-1,3-thiazol-5-yl)methylamino]acetonitrile |
|---|---|
| PubChem CID | 61280637 |
| Molecular Formula | C7H9N3S |
| Molecular Weight | 167.24 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 2-[(2-methyl-1,3-thiazol-5-yl)methylamino]acetonitrile |
| SMILES | Cc1ncc(CNCC#N)s1 |
| InChI | InChI=1S/C7H9N3S/c1-6-10-5-7(11-6)4-9-3-2-8/h5,9H,3-4H2,1H3 |
| InChIKey | HBJCEVRXHBGJOC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|