C11H16N2S — CID 115694172
N-[(2-methyl-1,3-thiazol-5-yl)methyl]hex-5-yn-1-amine (PubChem CID 115694172) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is N-[(2-methyl-1,3-thiazol-5-yl)methyl]hex-5-yn-1-amine.
| Compound Name | N-[(2-methyl-1,3-thiazol-5-yl)methyl]hex-5-yn-1-amine |
|---|---|
| PubChem CID | 115694172 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | N-[(2-methyl-1,3-thiazol-5-yl)methyl]hex-5-yn-1-amine |
| SMILES | C#CCCCCNCc1cnc(C)s1 |
| InChI | InChI=1S/C11H16N2S/c1-3-4-5-6-7-12-8-11-9-13-10(2)14-11/h1,9,12H,4-8H2,2H3 |
| InChIKey | SRSYOJHHZWMTOF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|