C9H16N2O2S2 — CID 61019602
3-methylsulfonyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]propan-1-amine (PubChem CID 61019602) has the molecular formula C9H16N2O2S2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 3-methylsulfonyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]propan-1-amine.
| Compound Name | 3-methylsulfonyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 61019602 |
| Molecular Formula | C9H16N2O2S2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 3-methylsulfonyl-N-[(2-methyl-1,3-thiazol-5-yl)methyl]propan-1-amine |
| SMILES | Cc1ncc(CNCCCS(C)(=O)=O)s1 |
| InChI | InChI=1S/C9H16N2O2S2/c1-8-11-7-9(14-8)6-10-4-3-5-15(2,12)13/h7,10H,3-6H2,1-2H3 |
| InChIKey | UYLZYYRUBVHVDO-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|