C9H18ClN3O2S2 — CID 115596007
N,N-dimethyl-5-[(2-methylsulfonylethylamino)methyl]-1,3-thiazol-2-amine;hydrochloride (PubChem CID 115596007) has the molecular formula C9H18ClN3O2S2 and a molecular weight of 299.85 g/mol. Its IUPAC name is N,N-dimethyl-5-[(2-methylsulfonylethylamino)methyl]-1,3-thiazol-2-amine;hydrochloride.
| Compound Name | N,N-dimethyl-5-[(2-methylsulfonylethylamino)methyl]-1,3-thiazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 115596007 |
| Molecular Formula | C9H18ClN3O2S2 |
| Molecular Weight | 299.85 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | N,N-dimethyl-5-[(2-methylsulfonylethylamino)methyl]-1,3-thiazol-2-amine;hydrochloride |
| SMILES | CN(C)c1ncc(CNCCS(C)(=O)=O)s1.Cl |
| InChI | InChI=1S/C9H17N3O2S2.ClH/c1-12(2)9-11-7-8(15-9)6-10-4-5-16(3,13)14;/h7,10H,4-6H2,1-3H3;1H |
| InChIKey | GAHYMWMBJYVAMU-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.85 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|