C11H22ClN3OS — CID 115587033
5-[(3-ethoxypropylamino)methyl]-N,N-dimethyl-1,3-thiazol-2-amine;hydrochloride (PubChem CID 115587033) has the molecular formula C11H22ClN3OS and a molecular weight of 279.84 g/mol. Its IUPAC name is 5-[(3-ethoxypropylamino)methyl]-N,N-dimethyl-1,3-thiazol-2-amine;hydrochloride.
| Compound Name | 5-[(3-ethoxypropylamino)methyl]-N,N-dimethyl-1,3-thiazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 115587033 |
| Molecular Formula | C11H22ClN3OS |
| Molecular Weight | 279.84 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 5-[(3-ethoxypropylamino)methyl]-N,N-dimethyl-1,3-thiazol-2-amine;hydrochloride |
| SMILES | CCOCCCNCc1cnc(N(C)C)s1.Cl |
| InChI | InChI=1S/C11H21N3OS.ClH/c1-4-15-7-5-6-12-8-10-9-13-11(16-10)14(2)3;/h9,12H,4-8H2,1-3H3;1H |
| InChIKey | ITPCPKOUNLWKPJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.84 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|