C10H15Br2NOS — CID 102830644
N-[(4,5-dibromothiophen-2-yl)methyl]-3-ethoxypropan-1-amine (PubChem CID 102830644) has the molecular formula C10H15Br2NOS and a molecular weight of 357.11 g/mol. Its IUPAC name is N-[(4,5-dibromothiophen-2-yl)methyl]-3-ethoxypropan-1-amine.
| Compound Name | N-[(4,5-dibromothiophen-2-yl)methyl]-3-ethoxypropan-1-amine |
|---|---|
| PubChem CID | 102830644 |
| Molecular Formula | C10H15Br2NOS |
| Molecular Weight | 357.11 g/mol |
| Exact Mass | 354.92 |
| IUPAC Name | N-[(4,5-dibromothiophen-2-yl)methyl]-3-ethoxypropan-1-amine |
| SMILES | CCOCCCNCc1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C10H15Br2NOS/c1-2-14-5-3-4-13-7-8-6-9(11)10(12)15-8/h6,13H,2-5,7H2,1H3 |
| InChIKey | HYPYBRITBOHTQN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.11 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|