C8H11Br2NOS — CID 80536287
N-[(4,5-dibromothiophen-2-yl)methyl]-2-methoxyethanamine (PubChem CID 80536287) has the molecular formula C8H11Br2NOS and a molecular weight of 329.06 g/mol. Its IUPAC name is N-[(4,5-dibromothiophen-2-yl)methyl]-2-methoxyethanamine.
| Compound Name | N-[(4,5-dibromothiophen-2-yl)methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 80536287 |
| Molecular Formula | C8H11Br2NOS |
| Molecular Weight | 329.06 g/mol |
| Exact Mass | 326.89 |
| IUPAC Name | N-[(4,5-dibromothiophen-2-yl)methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C8H11Br2NOS/c1-12-3-2-11-5-6-4-7(9)8(10)13-6/h4,11H,2-3,5H2,1H3 |
| InChIKey | AYWSEMSZEXFCRZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.06 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|