C6H7Br2NOS — CID 102837054
1-(4,5-dibromothiophen-2-yl)-N-methoxymethanamine (PubChem CID 102837054) has the molecular formula C6H7Br2NOS and a molecular weight of 301.00 g/mol. Its IUPAC name is 1-(4,5-dibromothiophen-2-yl)-N-methoxymethanamine.
| Compound Name | 1-(4,5-dibromothiophen-2-yl)-N-methoxymethanamine |
|---|---|
| PubChem CID | 102837054 |
| Molecular Formula | C6H7Br2NOS |
| Molecular Weight | 301.00 g/mol |
| Exact Mass | 298.86 |
| IUPAC Name | 1-(4,5-dibromothiophen-2-yl)-N-methoxymethanamine |
| SMILES | CONCc1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C6H7Br2NOS/c1-10-9-3-4-2-5(7)6(8)11-4/h2,9H,3H2,1H3 |
| InChIKey | XVNXULHJPCHLIG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.00 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|