C5H6Br2N2S — CID 80536373
(4,5-dibromothiophen-2-yl)methylhydrazine (PubChem CID 80536373) has the molecular formula C5H6Br2N2S and a molecular weight of 285.99 g/mol. Its IUPAC name is (4,5-dibromothiophen-2-yl)methylhydrazine.
| Compound Name | (4,5-dibromothiophen-2-yl)methylhydrazine |
|---|---|
| PubChem CID | 80536373 |
| Molecular Formula | C5H6Br2N2S |
| Molecular Weight | 285.99 g/mol |
| Exact Mass | 283.86 |
| IUPAC Name | (4,5-dibromothiophen-2-yl)methylhydrazine |
| SMILES | NNCc1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C5H6Br2N2S/c6-4-1-3(2-9-8)10-5(4)7/h1,9H,2,8H2 |
| InChIKey | KNGAKYXNUWRCMY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.99 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|