C6H5Br3S — CID 102844918
2,3-dibromo-5-(2-bromoethyl)thiophene (PubChem CID 102844918) has the molecular formula C6H5Br3S and a molecular weight of 348.89 g/mol. Its IUPAC name is 2,3-dibromo-5-(2-bromoethyl)thiophene.
| Compound Name | 2,3-dibromo-5-(2-bromoethyl)thiophene |
|---|---|
| PubChem CID | 102844918 |
| Molecular Formula | C6H5Br3S |
| Molecular Weight | 348.89 g/mol |
| Exact Mass | 345.77 |
| IUPAC Name | 2,3-dibromo-5-(2-bromoethyl)thiophene |
| SMILES | BrCCc1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C6H5Br3S/c7-2-1-4-3-5(8)6(9)10-4/h3H,1-2H2 |
| InChIKey | WMNXGVGLCGGBRQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.89 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|