C8H11Br2NO2S — CID 102836172
2-[(4,5-dibromothiophen-2-yl)methylamino]propane-1,3-diol (PubChem CID 102836172) has the molecular formula C8H11Br2NO2S and a molecular weight of 345.06 g/mol. Its IUPAC name is 2-[(4,5-dibromothiophen-2-yl)methylamino]propane-1,3-diol.
| Compound Name | 2-[(4,5-dibromothiophen-2-yl)methylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 102836172 |
| Molecular Formula | C8H11Br2NO2S |
| Molecular Weight | 345.06 g/mol |
| Exact Mass | 342.89 |
| IUPAC Name | 2-[(4,5-dibromothiophen-2-yl)methylamino]propane-1,3-diol |
| SMILES | OCC(CO)NCc1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C8H11Br2NO2S/c9-7-1-6(14-8(7)10)2-11-5(3-12)4-13/h1,5,11-13H,2-4H2 |
| InChIKey | BNRMRYACAVEINW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.06 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |