C9H14BrNOS — CID 102831611
2-[(4-bromo-5-methylthiophen-2-yl)methylamino]propan-1-ol (PubChem CID 102831611) has the molecular formula C9H14BrNOS and a molecular weight of 264.19 g/mol. Its IUPAC name is 2-[(4-bromo-5-methylthiophen-2-yl)methylamino]propan-1-ol.
| Compound Name | 2-[(4-bromo-5-methylthiophen-2-yl)methylamino]propan-1-ol |
|---|---|
| PubChem CID | 102831611 |
| Molecular Formula | C9H14BrNOS |
| Molecular Weight | 264.19 g/mol |
| Exact Mass | 263.00 |
| IUPAC Name | 2-[(4-bromo-5-methylthiophen-2-yl)methylamino]propan-1-ol |
| SMILES | Cc1sc(CNC(C)CO)cc1Br |
| InChI | InChI=1S/C9H14BrNOS/c1-6(5-12)11-4-8-3-9(10)7(2)13-8/h3,6,11-12H,4-5H2,1-2H3 |
| InChIKey | DTLOSEUOJRMZLA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.19 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |