C11H18BrNS — CID 102830099
N-[(4-bromo-5-methylthiophen-2-yl)methyl]pentan-2-amine (PubChem CID 102830099) has the molecular formula C11H18BrNS and a molecular weight of 276.24 g/mol. Its IUPAC name is N-[(4-bromo-5-methylthiophen-2-yl)methyl]pentan-2-amine.
| Compound Name | N-[(4-bromo-5-methylthiophen-2-yl)methyl]pentan-2-amine |
|---|---|
| PubChem CID | 102830099 |
| Molecular Formula | C11H18BrNS |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | N-[(4-bromo-5-methylthiophen-2-yl)methyl]pentan-2-amine |
| SMILES | CCCC(C)NCc1cc(Br)c(C)s1 |
| InChI | InChI=1S/C11H18BrNS/c1-4-5-8(2)13-7-10-6-11(12)9(3)14-10/h6,8,13H,4-5,7H2,1-3H3 |
| InChIKey | LWIAPLDYLHDQKF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |