C11H18BrNOS — CID 102836538
4-[(4-bromo-5-methylthiophen-2-yl)methylamino]pentan-1-ol (PubChem CID 102836538) has the molecular formula C11H18BrNOS and a molecular weight of 292.24 g/mol. Its IUPAC name is 4-[(4-bromo-5-methylthiophen-2-yl)methylamino]pentan-1-ol.
| Compound Name | 4-[(4-bromo-5-methylthiophen-2-yl)methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 102836538 |
| Molecular Formula | C11H18BrNOS |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 4-[(4-bromo-5-methylthiophen-2-yl)methylamino]pentan-1-ol |
| SMILES | Cc1sc(CNC(C)CCCO)cc1Br |
| InChI | InChI=1S/C11H18BrNOS/c1-8(4-3-5-14)13-7-10-6-11(12)9(2)15-10/h6,8,13-14H,3-5,7H2,1-2H3 |
| InChIKey | RAGKVRIRABTRIF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |