C12H19NO3S — CID 82888365
2-[5-[(5-hydroxypentan-2-ylamino)methyl]thiophen-2-yl]acetic acid (PubChem CID 82888365) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is 2-[5-[(5-hydroxypentan-2-ylamino)methyl]thiophen-2-yl]acetic acid.
| Compound Name | 2-[5-[(5-hydroxypentan-2-ylamino)methyl]thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 82888365 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 2-[5-[(5-hydroxypentan-2-ylamino)methyl]thiophen-2-yl]acetic acid |
| SMILES | CC(CCCO)NCc1ccc(CC(=O)O)s1 |
| InChI | InChI=1S/C12H19NO3S/c1-9(3-2-6-14)13-8-11-5-4-10(17-11)7-12(15)16/h4-5,9,13-14H,2-3,6-8H2,1H3,(H,15,16) |
| InChIKey | XGXXZZFDLKZRNC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |