C13H20ClNO2S — CID 65289196
6-[(5-chlorothiophen-2-yl)methylamino]-2-methylheptanoic acid (PubChem CID 65289196) has the molecular formula C13H20ClNO2S and a molecular weight of 289.83 g/mol. Its IUPAC name is 6-[(5-chlorothiophen-2-yl)methylamino]-2-methylheptanoic acid.
| Compound Name | 6-[(5-chlorothiophen-2-yl)methylamino]-2-methylheptanoic acid |
|---|---|
| PubChem CID | 65289196 |
| Molecular Formula | C13H20ClNO2S |
| Molecular Weight | 289.83 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 6-[(5-chlorothiophen-2-yl)methylamino]-2-methylheptanoic acid |
| SMILES | CC(CCCC(C)C(=O)O)NCc1ccc(Cl)s1 |
| InChI | InChI=1S/C13H20ClNO2S/c1-9(13(16)17)4-3-5-10(2)15-8-11-6-7-12(14)18-11/h6-7,9-10,15H,3-5,8H2,1-2H3,(H,16,17) |
| InChIKey | GYQMMSQLLDUMCN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.83 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |