C13H22ClN3O2 — CID 65288998
6-[(5-chloro-1-methylimidazol-2-yl)methylamino]-2-methylheptanoic acid (PubChem CID 65288998) has the molecular formula C13H22ClN3O2 and a molecular weight of 287.79 g/mol. Its IUPAC name is 6-[(5-chloro-1-methylimidazol-2-yl)methylamino]-2-methylheptanoic acid.
| Compound Name | 6-[(5-chloro-1-methylimidazol-2-yl)methylamino]-2-methylheptanoic acid |
|---|---|
| PubChem CID | 65288998 |
| Molecular Formula | C13H22ClN3O2 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 6-[(5-chloro-1-methylimidazol-2-yl)methylamino]-2-methylheptanoic acid |
| SMILES | CC(CCCC(C)C(=O)O)NCc1ncc(Cl)n1C |
| InChI | InChI=1S/C13H22ClN3O2/c1-9(13(18)19)5-4-6-10(2)15-8-12-16-7-11(14)17(12)3/h7,9-10,15H,4-6,8H2,1-3H3,(H,18,19) |
| InChIKey | GNIIRKJQLVUCAR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |