C10H18ClN3O — CID 79249698
(2S)-2-[(5-chloro-1-methylimidazol-2-yl)methylamino]-3-methylbutan-1-ol (PubChem CID 79249698) has the molecular formula C10H18ClN3O and a molecular weight of 231.73 g/mol. Its IUPAC name is (2S)-2-[(5-chloro-1-methylimidazol-2-yl)methylamino]-3-methylbutan-1-ol.
| Compound Name | (2S)-2-[(5-chloro-1-methylimidazol-2-yl)methylamino]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 79249698 |
| Molecular Formula | C10H18ClN3O |
| Molecular Weight | 231.73 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (2S)-2-[(5-chloro-1-methylimidazol-2-yl)methylamino]-3-methylbutan-1-ol |
| SMILES | CC(C)[C@@H](CO)NCc1ncc(Cl)n1C |
| InChI | InChI=1S/C10H18ClN3O/c1-7(2)8(6-15)12-5-10-13-4-9(11)14(10)3/h4,7-8,12,15H,5-6H2,1-3H3/t8-/m1/s1 |
| InChIKey | PGFVILLYVYFQOE-MRVPVSSYSA-N |
| XLogP | 1.18 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.73 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |