C11H19ClN4O — CID 113406905
2-[(5-chloro-1-methylimidazol-2-yl)methylamino]-N-propan-2-ylpropanamide (PubChem CID 113406905) has the molecular formula C11H19ClN4O and a molecular weight of 258.75 g/mol. Its IUPAC name is 2-[(5-chloro-1-methylimidazol-2-yl)methylamino]-N-propan-2-ylpropanamide.
| Compound Name | 2-[(5-chloro-1-methylimidazol-2-yl)methylamino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 113406905 |
| Molecular Formula | C11H19ClN4O |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2-[(5-chloro-1-methylimidazol-2-yl)methylamino]-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)C(C)NCc1ncc(Cl)n1C |
| InChI | InChI=1S/C11H19ClN4O/c1-7(2)15-11(17)8(3)13-6-10-14-5-9(12)16(10)4/h5,7-8,13H,6H2,1-4H3,(H,15,17) |
| InChIKey | UIMIVHPCPYKBCA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |