C9H15ClN4O — CID 43401730
2-[(5-chloro-1-methylimidazol-2-yl)methylamino]-N-ethylacetamide (PubChem CID 43401730) has the molecular formula C9H15ClN4O and a molecular weight of 230.70 g/mol. Its IUPAC name is 2-[(5-chloro-1-methylimidazol-2-yl)methylamino]-N-ethylacetamide.
| Compound Name | 2-[(5-chloro-1-methylimidazol-2-yl)methylamino]-N-ethylacetamide |
|---|---|
| PubChem CID | 43401730 |
| Molecular Formula | C9H15ClN4O |
| Molecular Weight | 230.70 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-[(5-chloro-1-methylimidazol-2-yl)methylamino]-N-ethylacetamide |
| SMILES | CCNC(=O)CNCc1ncc(Cl)n1C |
| InChI | InChI=1S/C9H15ClN4O/c1-3-12-9(15)6-11-5-8-13-4-7(10)14(8)2/h4,11H,3,5-6H2,1-2H3,(H,12,15) |
| InChIKey | WKOGPFLPGIGNSL-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.70 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |