C11H16ClN5 — CID 62222511
N-[[1-[(5-chloro-1-methylimidazol-2-yl)methyl]imidazol-2-yl]methyl]ethanamine (PubChem CID 62222511) has the molecular formula C11H16ClN5 and a molecular weight of 253.74 g/mol. Its IUPAC name is N-[[1-[(5-chloro-1-methylimidazol-2-yl)methyl]imidazol-2-yl]methyl]ethanamine.
| Compound Name | N-[[1-[(5-chloro-1-methylimidazol-2-yl)methyl]imidazol-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 62222511 |
| Molecular Formula | C11H16ClN5 |
| Molecular Weight | 253.74 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-[[1-[(5-chloro-1-methylimidazol-2-yl)methyl]imidazol-2-yl]methyl]ethanamine |
| SMILES | CCNCc1nccn1Cc1ncc(Cl)n1C |
| InChI | InChI=1S/C11H16ClN5/c1-3-13-7-10-14-4-5-17(10)8-11-15-6-9(12)16(11)2/h4-6,13H,3,7-8H2,1-2H3 |
| InChIKey | XNUSKGDNCKLTJK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.74 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |